C21H25IO9 — CID 146276746
diethyl 2-[[(2R,3S,4R)-3-ethynyl-3,4,5-trihydroxyoxolan-2-yl]methoxy]-2-[(4-iodophenyl)methyl]propanedioate (PubChem CID 146276746) has the molecular formula C21H25IO9 and a molecular weight of 548.33 g/mol. Its IUPAC name is diethyl 2-[[(2R,3S,4R)-3-ethynyl-3,4,5-trihydroxyoxolan-2-yl]methoxy]-2-[(4-iodophenyl)methyl]propanedioate.
| Compound Name | diethyl 2-[[(2R,3S,4R)-3-ethynyl-3,4,5-trihydroxyoxolan-2-yl]methoxy]-2-[(4-iodophenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 146276746 |
| Molecular Formula | C21H25IO9 |
| Molecular Weight | 548.33 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | diethyl 2-[[(2R,3S,4R)-3-ethynyl-3,4,5-trihydroxyoxolan-2-yl]methoxy]-2-[(4-iodophenyl)methyl]propanedioate |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccc(I)cc2)(C(=O)OCC)C(=O)OCC)OC(O)[C@@H]1O |
| InChI | InChI=1S/C21H25IO9/c1-4-20(27)15(31-17(24)16(20)23)12-30-21(18(25)28-5-2,19(26)29-6-3)11-13-7-9-14(22)10-8-13/h1,7-10,15-17,23-24,27H,5-6,11-12H2,2-3H3/t15-,16+,17?,20-/m1/s1 |
| InChIKey | RVSCFEZTMAVSBH-YUBNGQEKSA-N |
| XLogP | 0.16 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|