C19H26N2O6 — CID 135194250
2-[(2-methylpropan-2-yl)oxymethyl]-2-[[4-(2-oxo-1,3-diazinan-1-yl)phenyl]methyl]propanedioic acid (PubChem CID 135194250) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxymethyl]-2-[[4-(2-oxo-1,3-diazinan-1-yl)phenyl]methyl]propanedioic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxymethyl]-2-[[4-(2-oxo-1,3-diazinan-1-yl)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 135194250 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxymethyl]-2-[[4-(2-oxo-1,3-diazinan-1-yl)phenyl]methyl]propanedioic acid |
| SMILES | CC(C)(C)OCC(Cc1ccc(N2CCCNC2=O)cc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H26N2O6/c1-18(2,3)27-12-19(15(22)23,16(24)25)11-13-5-7-14(8-6-13)21-10-4-9-20-17(21)26/h5-8H,4,9-12H2,1-3H3,(H,20,26)(H,22,23)(H,24,25) |
| InChIKey | HEHOVZRILDLNIO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|