C16H24N4O2 — CID 110666800
1-(2,2-dimethylpropyl)-3-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]urea (PubChem CID 110666800) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]urea.
| Compound Name | 1-(2,2-dimethylpropyl)-3-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 110666800 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]urea |
| SMILES | CC(C)(C)CNC(=O)Nc1ccc(N2CCCNC2=O)cc1 |
| InChI | InChI=1S/C16H24N4O2/c1-16(2,3)11-18-14(21)19-12-5-7-13(8-6-12)20-10-4-9-17-15(20)22/h5-8H,4,9-11H2,1-3H3,(H,17,22)(H2,18,19,21) |
| InChIKey | YCTHSMXRVOHMAR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |