C18H28N4O2 — CID 110673110
1-[4-(4-acetylpiperazin-1-yl)phenyl]-3-(2,2-dimethylpropyl)urea (PubChem CID 110673110) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-[4-(4-acetylpiperazin-1-yl)phenyl]-3-(2,2-dimethylpropyl)urea.
| Compound Name | 1-[4-(4-acetylpiperazin-1-yl)phenyl]-3-(2,2-dimethylpropyl)urea |
|---|---|
| PubChem CID | 110673110 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-[4-(4-acetylpiperazin-1-yl)phenyl]-3-(2,2-dimethylpropyl)urea |
| SMILES | CC(=O)N1CCN(c2ccc(NC(=O)NCC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C18H28N4O2/c1-14(23)21-9-11-22(12-10-21)16-7-5-15(6-8-16)20-17(24)19-13-18(2,3)4/h5-8H,9-13H2,1-4H3,(H2,19,20,24) |
| InChIKey | SBTXKLIFPZAYJA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|