C18H19N3O3 — CID 110666721
benzyl N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]carbamate (PubChem CID 110666721) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is benzyl N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]carbamate.
| Compound Name | benzyl N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 110666721 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | benzyl N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(N2CCCNC2=O)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H19N3O3/c22-17-19-11-4-12-21(17)16-9-7-15(8-10-16)20-18(23)24-13-14-5-2-1-3-6-14/h1-3,5-10H,4,11-13H2,(H,19,22)(H,20,23) |
| InChIKey | LDIMQEWUURMSGZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |