C20H23N3O3 — CID 110666646
N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]-4-phenoxybutanamide (PubChem CID 110666646) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]-4-phenoxybutanamide.
| Compound Name | N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 110666646 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]-4-phenoxybutanamide |
| SMILES | O=C(CCCOc1ccccc1)Nc1ccc(N2CCCNC2=O)cc1 |
| InChI | InChI=1S/C20H23N3O3/c24-19(8-4-15-26-18-6-2-1-3-7-18)22-16-9-11-17(12-10-16)23-14-5-13-21-20(23)25/h1-3,6-7,9-12H,4-5,8,13-15H2,(H,21,25)(H,22,24) |
| InChIKey | ORLYJQFJVHSABA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|