C17H18N2O4S — CID 7627537
benzyl N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]carbamate (PubChem CID 7627537) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is benzyl N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]carbamate.
| Compound Name | benzyl N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 7627537 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | benzyl N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(N2CCCS2(=O)=O)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C17H18N2O4S/c20-17(23-13-14-5-2-1-3-6-14)18-15-7-9-16(10-8-15)19-11-4-12-24(19,21)22/h1-3,5-10H,4,11-13H2,(H,18,20) |
| InChIKey | NGZAXMDAVFCFCS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |