C21H22N4O5S — CID 124852077
2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]acetamide (PubChem CID 124852077) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]acetamide.
| Compound Name | 2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 124852077 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]acetamide |
| SMILES | O=C(C[C@H]1NC(=O)N(Cc2ccccc2)C1=O)Nc1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C21H22N4O5S/c26-19(22-16-7-9-17(10-8-16)25-11-4-12-31(25,29)30)13-18-20(27)24(21(28)23-18)14-15-5-2-1-3-6-15/h1-3,5-10,18H,4,11-14H2,(H,22,26)(H,23,28)/t18-/m1/s1 |
| InChIKey | UEGUDOLBBKVSAQ-GOSISDBHSA-N |
| XLogP | 1.68 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|