C26H34O9 — CID 101348360
diethyl 2-benzyl-2-[(2R,5S)-5-(1,3-diethoxy-2-methyl-1,3-dioxopropan-2-yl)-2,5-dihydrofuran-2-yl]propanedioate (PubChem CID 101348360) has the molecular formula C26H34O9 and a molecular weight of 490.55 g/mol. Its IUPAC name is diethyl 2-benzyl-2-[(2R,5S)-5-(1,3-diethoxy-2-methyl-1,3-dioxopropan-2-yl)-2,5-dihydrofuran-2-yl]propanedioate.
| Compound Name | diethyl 2-benzyl-2-[(2R,5S)-5-(1,3-diethoxy-2-methyl-1,3-dioxopropan-2-yl)-2,5-dihydrofuran-2-yl]propanedioate |
|---|---|
| PubChem CID | 101348360 |
| Molecular Formula | C26H34O9 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | diethyl 2-benzyl-2-[(2R,5S)-5-(1,3-diethoxy-2-methyl-1,3-dioxopropan-2-yl)-2,5-dihydrofuran-2-yl]propanedioate |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)[C@@H]1C=C[C@H](C(Cc2ccccc2)(C(=O)OCC)C(=O)OCC)O1 |
| InChI | InChI=1S/C26H34O9/c1-6-31-21(27)25(5,22(28)32-7-2)19-15-16-20(35-19)26(23(29)33-8-3,24(30)34-9-4)17-18-13-11-10-12-14-18/h10-16,19-20H,6-9,17H2,1-5H3/t19-,20+/m0/s1 |
| InChIKey | RXDUHCPOTSOKPG-VQTJNVASSA-N |
| XLogP | 2.80 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|