About azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide
azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide (PubChem CID 174880541) has the molecular formula C14H25IN2O2
and a molecular weight of 380.27 g/mol. Its IUPAC name is azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide.
Molecular Properties
| Compound Name | azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide |
| PubChem CID | 174880541 |
| Molecular Formula | C14H25IN2O2 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide |
| SMILES | CCOC(=O)C(C)(Cc1ccccc1)N(C)C.I.N |
| InChI | InChI=1S/C14H21NO2.HI.H3N/c1-5-17-13(16)14(2,15(3)4)11-12-9-7-6-8-10-12;;/h6-10H,5,11H2,1-4H3;1H;1H3 |
| InChIKey | XNMBPFLYOHJFFY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide?
The IUPAC name of azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide (CID 174880541) is azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide.
What is the SMILES notation for azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide?
The canonical SMILES for azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide is CCOC(=O)C(C)(Cc1ccccc1)N(C)C.I.N.
What is the InChIKey of azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide?
The InChIKey is XNMBPFLYOHJFFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2.HI.H3N/c1-5-17-13(16)14(2,15(3)4)11-12-9-7-6-8-10-12;;/h6-10H,5,11H2,1-4H3;1H;1H3.
What are the key properties of azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide?
azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide has a molecular weight of 380.27 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethyl 2-(dimethylamino)-2-methyl-3-phenylpropanoate;hydroiodide is sourced from PubChem (CID 174880541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).