C18H18ClN9O6S — CID 135156841
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)-3-thiophen-3-ylpropanoic acid (PubChem CID 135156841) has the molecular formula C18H18ClN9O6S and a molecular weight of 523.92 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)-3-thiophen-3-ylpropanoic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)-3-thiophen-3-ylpropanoic acid |
|---|---|
| PubChem CID | 135156841 |
| Molecular Formula | C18H18ClN9O6S |
| Molecular Weight | 523.92 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)-3-thiophen-3-ylpropanoic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COC(Cc2ccsc2)(C(=O)O)c2nn[nH]n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H18ClN9O6S/c19-17-22-12(20)9-13(23-17)28(6-21-9)14-11(30)10(29)8(34-14)4-33-18(16(31)32,15-24-26-27-25-15)3-7-1-2-35-5-7/h1-2,5-6,8,10-11,14,29-30H,3-4H2,(H,31,32)(H2,20,22,23)(H,24,25,26,27)/t8-,10-,11-,14-,18?/m1/s1 |
| InChIKey | DFCSYRVWLADPFM-VSSHJLDXSA-N |
| XLogP | -0.50 |
| TPSA | 220.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.92 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |