C29H23ClFN7O5S — CID 166028157
2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-3-[4-(2-isocyanophenyl)phenyl]-2-(1,3-thiazol-4-yl)propanoic acid (PubChem CID 166028157) has the molecular formula C29H23ClFN7O5S and a molecular weight of 636.07 g/mol. Its IUPAC name is 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-3-[4-(2-isocyanophenyl)phenyl]-2-(1,3-thiazol-4-yl)propanoic acid.
| Compound Name | 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-3-[4-(2-isocyanophenyl)phenyl]-2-(1,3-thiazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 166028157 |
| Molecular Formula | C29H23ClFN7O5S |
| Molecular Weight | 636.07 g/mol |
| Exact Mass | 635.12 |
| IUPAC Name | 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-3-[4-(2-isocyanophenyl)phenyl]-2-(1,3-thiazol-4-yl)propanoic acid |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc(CC(OC[C@H]2O[C@@H](n3cnc4c(N)nc(Cl)nc43)[C@@H](F)[C@@H]2O)(C(=O)O)c2cscn2)cc1 |
| InChI | InChI=1S/C29H23ClFN7O5S/c1-33-18-5-3-2-4-17(18)16-8-6-15(7-9-16)10-29(27(40)41,20-12-44-14-35-20)42-11-19-23(39)21(31)26(43-19)38-13-34-22-24(32)36-28(30)37-25(22)38/h2-9,12-14,19,21,23,26,39H,10-11H2,(H,40,41)(H2,32,36,37)/t19-,21+,23-,26-,29?/m1/s1 |
| InChIKey | VCWCEBVLSDSWEV-KSVDRFCDSA-N |
| XLogP | 4.57 |
| TPSA | 162.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.07 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|