C34H34ClFN6O7S — CID 167197446
methyl 2-[4-[2-[[(2R,3R,4S,5R)-5-[2-chloro-6-(propylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-3-methoxy-3-oxo-2-(1,3-thiazol-4-yl)propyl]phenyl]benzoate (PubChem CID 167197446) has the molecular formula C34H34ClFN6O7S and a molecular weight of 725.20 g/mol. Its IUPAC name is methyl 2-[4-[2-[[(2R,3R,4S,5R)-5-[2-chloro-6-(propylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-3-methoxy-3-oxo-2-(1,3-thiazol-4-yl)propyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[2-[[(2R,3R,4S,5R)-5-[2-chloro-6-(propylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-3-methoxy-3-oxo-2-(1,3-thiazol-4-yl)propyl]phenyl]benzoate |
|---|---|
| PubChem CID | 167197446 |
| Molecular Formula | C34H34ClFN6O7S |
| Molecular Weight | 725.20 g/mol |
| Exact Mass | 724.19 |
| IUPAC Name | methyl 2-[4-[2-[[(2R,3R,4S,5R)-5-[2-chloro-6-(propylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-3-methoxy-3-oxo-2-(1,3-thiazol-4-yl)propyl]phenyl]benzoate |
| SMILES | CCCNc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COC(Cc2ccc(-c3ccccc3C(=O)OC)cc2)(C(=O)OC)c2cscn2)[C@@H](O)[C@@H]1F |
| InChI | InChI=1S/C34H34ClFN6O7S/c1-4-13-37-28-26-29(41-33(35)40-28)42(17-38-26)30-25(36)27(43)23(49-30)15-48-34(32(45)47-3,24-16-50-18-39-24)14-19-9-11-20(12-10-19)21-7-5-6-8-22(21)31(44)46-2/h5-12,16-18,23,25,27,30,43H,4,13-15H2,1-3H3,(H,37,40,41)/t23-,25+,27-,30-,34?/m1/s1 |
| InChIKey | JCFRMGPJPIMJOA-KSZGQIMUSA-N |
| XLogP | 5.14 |
| TPSA | 159.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.20 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |