C29H27ClN6O6S — CID 146276576
(2R)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]methoxy]-3-(4-phenylphenyl)-2-(1,3-thiazol-4-yl)propanoic acid (PubChem CID 146276576) has the molecular formula C29H27ClN6O6S and a molecular weight of 623.09 g/mol. Its IUPAC name is (2R)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]methoxy]-3-(4-phenylphenyl)-2-(1,3-thiazol-4-yl)propanoic acid.
| Compound Name | (2R)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]methoxy]-3-(4-phenylphenyl)-2-(1,3-thiazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 146276576 |
| Molecular Formula | C29H27ClN6O6S |
| Molecular Weight | 623.09 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | (2R)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]methoxy]-3-(4-phenylphenyl)-2-(1,3-thiazol-4-yl)propanoic acid |
| SMILES | C[C@@]1(O)[C@@H](CO[C@@](Cc2ccc(-c3ccccc3)cc2)(C(=O)O)c2cscn2)O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C29H27ClN6O6S/c1-28(40)20(42-25(22(28)37)36-14-32-21-23(31)34-27(30)35-24(21)36)12-41-29(26(38)39,19-13-43-15-33-19)11-16-7-9-18(10-8-16)17-5-3-2-4-6-17/h2-10,13-15,20,22,25,37,40H,11-12H2,1H3,(H,38,39)(H2,31,34,35)/t20-,22+,25-,28-,29-/m1/s1 |
| InChIKey | BQADBQDSVZWGKD-ZSYLJOELSA-N |
| XLogP | 3.43 |
| TPSA | 178.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.09 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |