C28H30ClN9O8 — CID 162533509
2-[4-[2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]methoxy]-2-carboxy-2-(tetrazolidin-5-yl)ethyl]phenyl]benzoic acid (PubChem CID 162533509) has the molecular formula C28H30ClN9O8 and a molecular weight of 656.06 g/mol. Its IUPAC name is 2-[4-[2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]methoxy]-2-carboxy-2-(tetrazolidin-5-yl)ethyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]methoxy]-2-carboxy-2-(tetrazolidin-5-yl)ethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 162533509 |
| Molecular Formula | C28H30ClN9O8 |
| Molecular Weight | 656.06 g/mol |
| Exact Mass | 655.19 |
| IUPAC Name | 2-[4-[2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]methoxy]-2-carboxy-2-(tetrazolidin-5-yl)ethyl]phenyl]benzoic acid |
| SMILES | C[C@@]1(O)[C@@H](COC(Cc2ccc(-c3ccccc3C(=O)O)cc2)(C(=O)O)C2NNNN2)O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C28H30ClN9O8/c1-27(44)17(46-22(19(27)39)38-12-31-18-20(30)32-26(29)33-21(18)38)11-45-28(25(42)43,24-34-36-37-35-24)10-13-6-8-14(9-7-13)15-4-2-3-5-16(15)23(40)41/h2-9,12,17,19,22,24,34-37,39,44H,10-11H2,1H3,(H,40,41)(H,42,43)(H2,30,32,33)/t17-,19+,22-,27-,28?/m1/s1 |
| InChIKey | RSGZPBINFGITDM-IXHRALMFSA-N |
| XLogP | -0.04 |
| TPSA | 251.26 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.06 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |