C29H22ClFN6O7S — CID 167197901
2-[4-[2-[[(1R,3R,4S,5R)-3-(6-amino-2-chloropurin-9-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-carboxy-2-(1,3-thiazol-4-yl)ethyl]phenyl]benzoic acid (PubChem CID 167197901) has the molecular formula C29H22ClFN6O7S and a molecular weight of 653.05 g/mol. Its IUPAC name is 2-[4-[2-[[(1R,3R,4S,5R)-3-(6-amino-2-chloropurin-9-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-carboxy-2-(1,3-thiazol-4-yl)ethyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[2-[[(1R,3R,4S,5R)-3-(6-amino-2-chloropurin-9-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-carboxy-2-(1,3-thiazol-4-yl)ethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 167197901 |
| Molecular Formula | C29H22ClFN6O7S |
| Molecular Weight | 653.05 g/mol |
| Exact Mass | 652.09 |
| IUPAC Name | 2-[4-[2-[[(1R,3R,4S,5R)-3-(6-amino-2-chloropurin-9-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-carboxy-2-(1,3-thiazol-4-yl)ethyl]phenyl]benzoic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@@H]2C(OC(Cc3ccc(-c4ccccc4C(=O)O)cc3)(C(=O)O)c3cscn3)[C@]2(O)[C@@H]1F |
| InChI | InChI=1S/C29H22ClFN6O7S/c30-27-35-22(32)18-23(36-27)37(11-33-18)24-19(31)29(42)20(43-24)21(29)44-28(26(40)41,17-10-45-12-34-17)9-13-5-7-14(8-6-13)15-3-1-2-4-16(15)25(38)39/h1-8,10-12,19-21,24,42H,9H2,(H,38,39)(H,40,41)(H2,32,35,36)/t19-,20-,21?,24-,28?,29+/m1/s1 |
| InChIKey | WPODQHOJZLXHLF-WTIGZKSQSA-N |
| XLogP | 3.47 |
| TPSA | 195.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.05 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |