C23H19ClFN5O9 — CID 134335992
2-[[(1R,3R,4S,5R,6S)-3-(6-amino-2-chloropurin-9-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-[[4-[(E)-2-carboxyethenyl]phenyl]methyl]propanedioic acid (PubChem CID 134335992) has the molecular formula C23H19ClFN5O9 and a molecular weight of 563.88 g/mol. Its IUPAC name is 2-[[(1R,3R,4S,5R,6S)-3-(6-amino-2-chloropurin-9-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-[[4-[(E)-2-carboxyethenyl]phenyl]methyl]propanedioic acid.
| Compound Name | 2-[[(1R,3R,4S,5R,6S)-3-(6-amino-2-chloropurin-9-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-[[4-[(E)-2-carboxyethenyl]phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 134335992 |
| Molecular Formula | C23H19ClFN5O9 |
| Molecular Weight | 563.88 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | 2-[[(1R,3R,4S,5R,6S)-3-(6-amino-2-chloropurin-9-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-[[4-[(E)-2-carboxyethenyl]phenyl]methyl]propanedioic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@@H]2[C@H](OC(Cc3ccc(/C=C/C(=O)O)cc3)(C(=O)O)C(=O)O)[C@]2(O)[C@@H]1F |
| InChI | InChI=1S/C23H19ClFN5O9/c24-21-28-16(26)12-17(29-21)30(8-27-12)18-13(25)23(37)14(38-18)15(23)39-22(19(33)34,20(35)36)7-10-3-1-9(2-4-10)5-6-11(31)32/h1-6,8,13-15,18,37H,7H2,(H,31,32)(H,33,34)(H,35,36)(H2,26,28,29)/b6-5+/t13-,14-,15+,18-,23+/m1/s1 |
| InChIKey | BJZCBKYAITUMOK-ZTHFKTSQSA-N |
| XLogP | 0.68 |
| TPSA | 220.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.88 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|