C15H16ClN5O10 — CID 167283806
2-[[(1R,3R,4R,5R)-3-(6-amino-2-chloropurin-9-yl)-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-(2,2-dihydroxyethyl)propanedioic acid (PubChem CID 167283806) has the molecular formula C15H16ClN5O10 and a molecular weight of 461.77 g/mol. Its IUPAC name is 2-[[(1R,3R,4R,5R)-3-(6-amino-2-chloropurin-9-yl)-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-(2,2-dihydroxyethyl)propanedioic acid.
| Compound Name | 2-[[(1R,3R,4R,5R)-3-(6-amino-2-chloropurin-9-yl)-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-(2,2-dihydroxyethyl)propanedioic acid |
|---|---|
| PubChem CID | 167283806 |
| Molecular Formula | C15H16ClN5O10 |
| Molecular Weight | 461.77 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 2-[[(1R,3R,4R,5R)-3-(6-amino-2-chloropurin-9-yl)-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-(2,2-dihydroxyethyl)propanedioic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@@H]2C(OC(CC(O)O)(C(=O)O)C(=O)O)[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C15H16ClN5O10/c16-13-19-8(17)4-9(20-13)21(2-18-4)10-5(24)15(29)6(30-10)7(15)31-14(11(25)26,12(27)28)1-3(22)23/h2-3,5-7,10,22-24,29H,1H2,(H,25,26)(H,27,28)(H2,17,19,20)/t5-,6+,7?,10+,15-/m0/s1 |
| InChIKey | XSHMLXMIXYMQBJ-HMQYSHEYSA-N |
| XLogP | -2.94 |
| TPSA | 243.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.77 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|