C22H20ClN5O10 — CID 135197334
2-[[(1R,3R,4R,5R)-3-(6-amino-2-chloropurin-9-yl)-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-[(4-carboxyphenyl)methyl]propanedioic acid (PubChem CID 135197334) has the molecular formula C22H20ClN5O10 and a molecular weight of 549.88 g/mol. Its IUPAC name is 2-[[(1R,3R,4R,5R)-3-(6-amino-2-chloropurin-9-yl)-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-[(4-carboxyphenyl)methyl]propanedioic acid.
| Compound Name | 2-[[(1R,3R,4R,5R)-3-(6-amino-2-chloropurin-9-yl)-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-[(4-carboxyphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 135197334 |
| Molecular Formula | C22H20ClN5O10 |
| Molecular Weight | 549.88 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | 2-[[(1R,3R,4R,5R)-3-(6-amino-2-chloropurin-9-yl)-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-2-[(4-carboxyphenyl)methyl]propanedioic acid |
| SMILES | C[C@]1(O)[C@H](n2cnc3c(N)nc(Cl)nc32)O[C@@H]2C(OC(Cc3ccc(C(=O)O)cc3)(C(=O)O)C(=O)O)[C@@]21O |
| InChI | InChI=1S/C22H20ClN5O10/c1-20(35)16(28-7-25-10-13(24)26-19(23)27-14(10)28)37-11-12(22(11,20)36)38-21(17(31)32,18(33)34)6-8-2-4-9(5-3-8)15(29)30/h2-5,7,11-12,16,35-36H,6H2,1H3,(H,29,30)(H,31,32)(H,33,34)(H2,24,26,27)/t11-,12?,16-,20+,22+/m1/s1 |
| InChIKey | NVUFFDPKKXXSIU-SHFUJAJQSA-N |
| XLogP | -0.31 |
| TPSA | 240.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.88 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|