C12H12FN5O4 — CID 24763960
(2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 24763960) has the molecular formula C12H12FN5O4 and a molecular weight of 309.26 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 24763960 |
| Molecular Formula | C12H12FN5O4 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C#C[C@@]1(O)[C@@H](CO)O[C@@H](n2cnc3c(N)nc(F)nc32)[C@@H]1O |
| InChI | InChI=1S/C12H12FN5O4/c1-2-12(21)5(3-19)22-10(7(12)20)18-4-15-6-8(14)16-11(13)17-9(6)18/h1,4-5,7,10,19-21H,3H2,(H2,14,16,17)/t5-,7+,10-,12-/m1/s1 |
| InChIKey | YYPKCOUKRGIGGT-OEBFKYMWSA-N |
| XLogP | -1.84 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|