C17H21N5O8S — CID 136714032
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-(8-amino-2-methylsulfanyl-6-oxo-1H-purin-9-yl)oxan-3-yl] acetate (PubChem CID 136714032) has the molecular formula C17H21N5O8S and a molecular weight of 455.45 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-diacetyloxy-6-(8-amino-2-methylsulfanyl-6-oxo-1H-purin-9-yl)oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-(8-amino-2-methylsulfanyl-6-oxo-1H-purin-9-yl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 136714032 |
| Molecular Formula | C17H21N5O8S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-(8-amino-2-methylsulfanyl-6-oxo-1H-purin-9-yl)oxan-3-yl] acetate |
| SMILES | CSc1nc2c(nc(N)n2[C@@H]2OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c(=O)[nH]1 |
| InChI | InChI=1S/C17H21N5O8S/c1-6(23)28-9-5-27-15(12(30-8(3)25)11(9)29-7(2)24)22-13-10(19-16(22)18)14(26)21-17(20-13)31-4/h9,11-12,15H,5H2,1-4H3,(H2,18,19)(H,20,21,26)/t9-,11+,12-,15-/m1/s1 |
| InChIKey | FXSNYPJVCPXJQE-JDTTZNEISA-N |
| XLogP | -0.25 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|