C17H20N2O9S — CID 136791325
[(3R,4S,5S,6S)-4,5-diacetyloxy-6-(5-formyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)oxan-3-yl] acetate (PubChem CID 136791325) has the molecular formula C17H20N2O9S and a molecular weight of 428.42 g/mol. Its IUPAC name is [(3R,4S,5S,6S)-4,5-diacetyloxy-6-(5-formyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5S,6S)-4,5-diacetyloxy-6-(5-formyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 136791325 |
| Molecular Formula | C17H20N2O9S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | [(3R,4S,5S,6S)-4,5-diacetyloxy-6-(5-formyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)oxan-3-yl] acetate |
| SMILES | CSc1nc([C@@H]2OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c(C=O)c(=O)[nH]1 |
| InChI | InChI=1S/C17H20N2O9S/c1-7(21)26-11-6-25-14(15(28-9(3)23)13(11)27-8(2)22)12-10(5-20)16(24)19-17(18-12)29-4/h5,11,13-15H,6H2,1-4H3,(H,18,19,24)/t11-,13+,14+,15-/m1/s1 |
| InChIKey | CFSUUPLAFHXUFQ-UQOMUDLDSA-N |
| XLogP | 0.17 |
| TPSA | 150.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|