C10H13FN6O3 — CID 90352589
(2S,3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-2-methyloxolane-2,3-diol (PubChem CID 90352589) has the molecular formula C10H13FN6O3 and a molecular weight of 284.25 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-2-methyloxolane-2,3-diol.
| Compound Name | (2S,3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-2-methyloxolane-2,3-diol |
|---|---|
| PubChem CID | 90352589 |
| Molecular Formula | C10H13FN6O3 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (2S,3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-2-methyloxolane-2,3-diol |
| SMILES | C[C@]1(O)O[C@@H](n2cnc3c(N)nc(N)nc32)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C10H13FN6O3/c1-10(19)5(18)3(11)8(20-10)17-2-14-4-6(12)15-9(13)16-7(4)17/h2-3,5,8,18-19H,1H3,(H4,12,13,15,16)/t3-,5+,8-,10+/m1/s1 |
| InChIKey | IYFGRIPXRMGHKF-SGTSVOGBSA-N |
| XLogP | -1.07 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |