C10H10F2N6O3 — CID 57291873
(2R)-2-(2,6-diaminopurin-9-yl)-5-(difluoromethylidene)oxolane-3,4-diol (PubChem CID 57291873) has the molecular formula C10H10F2N6O3 and a molecular weight of 300.23 g/mol. Its IUPAC name is (2R)-2-(2,6-diaminopurin-9-yl)-5-(difluoromethylidene)oxolane-3,4-diol.
| Compound Name | (2R)-2-(2,6-diaminopurin-9-yl)-5-(difluoromethylidene)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57291873 |
| Molecular Formula | C10H10F2N6O3 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (2R)-2-(2,6-diaminopurin-9-yl)-5-(difluoromethylidene)oxolane-3,4-diol |
| SMILES | Nc1nc(N)c2ncn([C@@H]3OC(=C(F)F)C(O)C3O)c2n1 |
| InChI | InChI=1S/C10H10F2N6O3/c11-6(12)5-3(19)4(20)9(21-5)18-1-15-2-7(13)16-10(14)17-8(2)18/h1,3-4,9,19-20H,(H4,13,14,16,17)/t3?,4?,9-/m1/s1 |
| InChIKey | GEOZDAGODYQSKX-GZMMWFTGSA-N |
| XLogP | -0.65 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |