C12H13N5O3 — CID 143260287
methyl 6-amino-9-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]purine-2-carboxylate (PubChem CID 143260287) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is methyl 6-amino-9-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]purine-2-carboxylate.
| Compound Name | methyl 6-amino-9-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]purine-2-carboxylate |
|---|---|
| PubChem CID | 143260287 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | methyl 6-amino-9-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]purine-2-carboxylate |
| SMILES | COC(=O)c1nc(N)c2ncn([C@H]3C=C[C@@H](O)C3)c2n1 |
| InChI | InChI=1S/C12H13N5O3/c1-20-12(19)10-15-9(13)8-11(16-10)17(5-14-8)6-2-3-7(18)4-6/h2-3,5-7,18H,4H2,1H3,(H2,13,15,16)/t6-,7+/m0/s1 |
| InChIKey | NRSBNGLVDZMHEG-NKWVEPMBSA-N |
| XLogP | 0.06 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|