C13H14ClN5O2 — CID 57055659
2-[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]propanoic acid (PubChem CID 57055659) has the molecular formula C13H14ClN5O2 and a molecular weight of 307.74 g/mol. Its IUPAC name is 2-[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]propanoic acid.
| Compound Name | 2-[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]propanoic acid |
|---|---|
| PubChem CID | 57055659 |
| Molecular Formula | C13H14ClN5O2 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)[C@@H]1C=C[C@H](n2cnc3c(Cl)nc(N)nc32)C1 |
| InChI | InChI=1S/C13H14ClN5O2/c1-6(12(20)21)7-2-3-8(4-7)19-5-16-9-10(14)17-13(15)18-11(9)19/h2-3,5-8H,4H2,1H3,(H,20,21)(H2,15,17,18)/t6?,7-,8+/m1/s1 |
| InChIKey | MXNWAPSPSJOTQT-VVXQKDJTSA-N |
| XLogP | 1.90 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|