C9H14Cl2N6S — CID 141031134
9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride (PubChem CID 141031134) has the molecular formula C9H14Cl2N6S and a molecular weight of 309.23 g/mol. Its IUPAC name is 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride.
| Compound Name | 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 141031134 |
| Molecular Formula | C9H14Cl2N6S |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1nc(N)c2ncn(C3CCSC3)c2n1 |
| InChI | InChI=1S/C9H12N6S.2ClH/c10-7-6-8(14-9(11)13-7)15(4-12-6)5-1-2-16-3-5;;/h4-5H,1-3H2,(H4,10,11,13,14);2*1H |
| InChIKey | BXOJTRAVUKTICT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |