About 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride
9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride (PubChem CID 141031134) has the molecular formula C9H14Cl2N6S
and a molecular weight of 309.23 g/mol. Its IUPAC name is 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride |
| PubChem CID | 141031134 |
| Molecular Formula | C9H14Cl2N6S |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1nc(N)c2ncn(C3CCSC3)c2n1 |
| InChI | InChI=1S/C9H12N6S.2ClH/c10-7-6-8(14-9(11)13-7)15(4-12-6)5-1-2-16-3-5;;/h4-5H,1-3H2,(H4,10,11,13,14);2*1H |
| InChIKey | BXOJTRAVUKTICT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride?
The IUPAC name of 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride (CID 141031134) is 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride.
What is the SMILES notation for 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride?
The canonical SMILES for 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride is Cl.Cl.Nc1nc(N)c2ncn(C3CCSC3)c2n1.
What is the InChIKey of 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride?
The InChIKey is BXOJTRAVUKTICT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N6S.2ClH/c10-7-6-8(14-9(11)13-7)15(4-12-6)5-1-2-16-3-5;;/h4-5H,1-3H2,(H4,10,11,13,14);2*1H.
What are the key properties of 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride?
9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride has a molecular weight of 309.23 g/mol, XLogP of 1.51, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(thiolan-3-yl)purine-2,6-diamine;dihydrochloride is sourced from PubChem (CID 141031134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).