C33H33Cl2N5O2 — CID 118595241
6-chloro-9-[(3R,4R,5R)-3-chloro-5-ethyl-3,4-dimethyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-2-amine (PubChem CID 118595241) has the molecular formula C33H33Cl2N5O2 and a molecular weight of 602.57 g/mol. Its IUPAC name is 6-chloro-9-[(3R,4R,5R)-3-chloro-5-ethyl-3,4-dimethyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-2-amine.
| Compound Name | 6-chloro-9-[(3R,4R,5R)-3-chloro-5-ethyl-3,4-dimethyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-2-amine |
|---|---|
| PubChem CID | 118595241 |
| Molecular Formula | C33H33Cl2N5O2 |
| Molecular Weight | 602.57 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | 6-chloro-9-[(3R,4R,5R)-3-chloro-5-ethyl-3,4-dimethyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-2-amine |
| SMILES | CC[C@H]1OC(n2cnc3c(Cl)nc(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)nc32)[C@](C)(Cl)[C@@H]1C |
| InChI | InChI=1S/C33H33Cl2N5O2/c1-5-26-21(2)32(3,35)30(42-26)40-20-36-27-28(34)37-31(38-29(27)40)39-33(22-12-8-6-9-13-22,23-14-10-7-11-15-23)24-16-18-25(41-4)19-17-24/h6-21,26,30H,5H2,1-4H3,(H,37,38,39)/t21-,26-,30?,32-/m1/s1 |
| InChIKey | IJVVXTQUDYZCGZ-VHRMESEISA-N |
| XLogP | 7.83 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.57 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|