C47H47ClN4O4Si — CID 15126199
(2R,3R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[4-chloro-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-3-ol (PubChem CID 15126199) has the molecular formula C47H47ClN4O4Si and a molecular weight of 795.46 g/mol. Its IUPAC name is (2R,3R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[4-chloro-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-3-ol.
| Compound Name | (2R,3R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[4-chloro-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 15126199 |
| Molecular Formula | C47H47ClN4O4Si |
| Molecular Weight | 795.46 g/mol |
| Exact Mass | 794.31 |
| IUPAC Name | (2R,3R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[4-chloro-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-3-ol |
| SMILES | COc1ccc(C(Nc2nc(Cl)c3ccn([C@H]4C[C@@H](O)[C@@H](CO[Si](c5ccccc5)(c5ccccc5)C(C)(C)C)O4)c3n2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C47H47ClN4O4Si/c1-46(2,3)57(37-21-13-7-14-22-37,38-23-15-8-16-24-38)55-32-41-40(53)31-42(56-41)52-30-29-39-43(48)49-45(50-44(39)52)51-47(33-17-9-5-10-18-33,34-19-11-6-12-20-34)35-25-27-36(54-4)28-26-35/h5-30,40-42,53H,31-32H2,1-4H3,(H,49,50,51)/t40-,41-,42-/m1/s1 |
| InChIKey | QWDNDKLCYMDMFS-ILGLXFKISA-N |
| XLogP | 8.72 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.46 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|