C53H39F2N5O8 — CID 134249549
[(2S,3S,4R,5R)-3,4-dibenzoyloxy-4-ethynyl-2-fluoro-5-[2-fluoro-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]oxolan-2-yl]methyl benzoate (PubChem CID 134249549) has the molecular formula C53H39F2N5O8 and a molecular weight of 911.92 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-3,4-dibenzoyloxy-4-ethynyl-2-fluoro-5-[2-fluoro-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3S,4R,5R)-3,4-dibenzoyloxy-4-ethynyl-2-fluoro-5-[2-fluoro-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 134249549 |
| Molecular Formula | C53H39F2N5O8 |
| Molecular Weight | 911.92 g/mol |
| Exact Mass | 911.28 |
| IUPAC Name | [(2S,3S,4R,5R)-3,4-dibenzoyloxy-4-ethynyl-2-fluoro-5-[2-fluoro-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]oxolan-2-yl]methyl benzoate |
| SMILES | C#C[C@]1(OC(=O)c2ccccc2)[C@H](n2cnc3c(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)nc(F)nc32)O[C@](F)(COC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C53H39F2N5O8/c1-3-51(67-47(63)37-23-13-6-14-24-37)48(66-46(62)36-21-11-5-12-22-36)52(55,33-65-45(61)35-19-9-4-10-20-35)68-49(51)60-34-56-42-43(57-50(54)58-44(42)60)59-53(38-25-15-7-16-26-38,39-27-17-8-18-28-39)40-29-31-41(64-2)32-30-40/h1,4-32,34,48-49H,33H2,2H3,(H,57,58,59)/t48-,49+,51+,52+/m0/s1 |
| InChIKey | YQXMSFXJFORNOR-YEXRLEHOSA-N |
| XLogP | 8.88 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.92 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|