C40H42FN5O5 — CID 166508179
[(2R,3S,5R)-2-ethynyl-5-[2-fluoro-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-3-hydroxyoxolan-2-yl]methyl 2-propylpentanoate (PubChem CID 166508179) has the molecular formula C40H42FN5O5 and a molecular weight of 691.80 g/mol. Its IUPAC name is [(2R,3S,5R)-2-ethynyl-5-[2-fluoro-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-3-hydroxyoxolan-2-yl]methyl 2-propylpentanoate.
| Compound Name | [(2R,3S,5R)-2-ethynyl-5-[2-fluoro-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-3-hydroxyoxolan-2-yl]methyl 2-propylpentanoate |
|---|---|
| PubChem CID | 166508179 |
| Molecular Formula | C40H42FN5O5 |
| Molecular Weight | 691.80 g/mol |
| Exact Mass | 691.32 |
| IUPAC Name | [(2R,3S,5R)-2-ethynyl-5-[2-fluoro-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-3-hydroxyoxolan-2-yl]methyl 2-propylpentanoate |
| SMILES | C#C[C@]1(COC(=O)C(CCC)CCC)O[C@@H](n2cnc3c(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C40H42FN5O5/c1-5-14-27(15-6-2)37(48)50-25-39(7-3)32(47)24-33(51-39)46-26-42-34-35(43-38(41)44-36(34)46)45-40(28-16-10-8-11-17-28,29-18-12-9-13-19-29)30-20-22-31(49-4)23-21-30/h3,8-13,16-23,26-27,32-33,47H,5-6,14-15,24-25H2,1-2,4H3,(H,43,44,45)/t32-,33+,39+/m0/s1 |
| InChIKey | YEMWVYDPICHBMF-SXEKBIGRSA-N |
| XLogP | 6.79 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.80 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|