C21H28N3O7P — CID 25154006
methyl 1-[(2R,3R,5S)-5-[(E)-2-diethoxyphosphorylethenyl]-3-phenylmethoxyoxolan-2-yl]-1,2,4-triazole-3-carboxylate (PubChem CID 25154006) has the molecular formula C21H28N3O7P and a molecular weight of 465.44 g/mol. Its IUPAC name is methyl 1-[(2R,3R,5S)-5-[(E)-2-diethoxyphosphorylethenyl]-3-phenylmethoxyoxolan-2-yl]-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-[(2R,3R,5S)-5-[(E)-2-diethoxyphosphorylethenyl]-3-phenylmethoxyoxolan-2-yl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 25154006 |
| Molecular Formula | C21H28N3O7P |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | methyl 1-[(2R,3R,5S)-5-[(E)-2-diethoxyphosphorylethenyl]-3-phenylmethoxyoxolan-2-yl]-1,2,4-triazole-3-carboxylate |
| SMILES | CCOP(=O)(/C=C/[C@@H]1C[C@@H](OCc2ccccc2)[C@H](n2cnc(C(=O)OC)n2)O1)OCC |
| InChI | InChI=1S/C21H28N3O7P/c1-4-29-32(26,30-5-2)12-11-17-13-18(28-14-16-9-7-6-8-10-16)20(31-17)24-15-22-19(23-24)21(25)27-3/h6-12,15,17-18,20H,4-5,13-14H2,1-3H3/b12-11+/t17-,18-,20-/m1/s1 |
| InChIKey | USRATFFFYMAWDC-MBKDTXBISA-N |
| XLogP | 3.72 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|