C11H11N3O2 — CID 67023628
methyl 1-benzyl-1,2,4-triazole-3-carboxylate (PubChem CID 67023628) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is methyl 1-benzyl-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-benzyl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 67023628 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | methyl 1-benzyl-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C11H11N3O2/c1-16-11(15)10-12-8-14(13-10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| InChIKey | MEYCNTRPZNJCBA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |