C14H15N3O3 — CID 44604341
methyl 1-(2-oxo-4-phenylbutyl)-1,2,4-triazole-3-carboxylate (PubChem CID 44604341) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl 1-(2-oxo-4-phenylbutyl)-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-(2-oxo-4-phenylbutyl)-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 44604341 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | methyl 1-(2-oxo-4-phenylbutyl)-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(CC(=O)CCc2ccccc2)n1 |
| InChI | InChI=1S/C14H15N3O3/c1-20-14(19)13-15-10-17(16-13)9-12(18)8-7-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3 |
| InChIKey | AKLPDFDXOALUEM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |