methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate

C7H8BrN3O2 — CID 78925163

IUPACmethyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate
SMILESC=C(Br)Cn1cnc(C(=O)OC)n1
InChIInChI=1S/C7H8BrN3O2/c1-5(8)3-11-4-9-6(10-11)7(12)13-2/h4H,1,3H2,2H3
InChIKeyQFCWFPSMNBYHNB-UHFFFAOYSA-N
MW246.06 g/mol
LogP0.97
Rot. Bonds3

About methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate

methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate (PubChem CID 78925163) has the molecular formula C7H8BrN3O2 and a molecular weight of 246.06 g/mol. Its IUPAC name is methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate.

Molecular Properties

Compound Namemethyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate
PubChem CID78925163
Molecular FormulaC7H8BrN3O2
Molecular Weight246.06 g/mol
Exact Mass244.98
IUPAC Namemethyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate
SMILESC=C(Br)Cn1cnc(C(=O)OC)n1
InChIInChI=1S/C7H8BrN3O2/c1-5(8)3-11-4-9-6(10-11)7(12)13-2/h4H,1,3H2,2H3
InChIKeyQFCWFPSMNBYHNB-UHFFFAOYSA-N
XLogP0.97
TPSA57.01 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.06
LogP ≤ 50.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate?
The IUPAC name of methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate (CID 78925163) is methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate?
The canonical SMILES for methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate is C=C(Br)Cn1cnc(C(=O)OC)n1.
What is the InChIKey of methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate?
The InChIKey is QFCWFPSMNBYHNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrN3O2/c1-5(8)3-11-4-9-6(10-11)7(12)13-2/h4H,1,3H2,2H3.
What are the key properties of methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate?
methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate has a molecular weight of 246.06 g/mol, XLogP of 0.97, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2-bromoprop-2-enyl)-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 78925163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).