C8H14N4O3 — CID 166457080
methyl 1-[2-(2-hydroxyethylamino)ethyl]-1,2,4-triazole-3-carboxylate (PubChem CID 166457080) has the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is methyl 1-[2-(2-hydroxyethylamino)ethyl]-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-[2-(2-hydroxyethylamino)ethyl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 166457080 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | methyl 1-[2-(2-hydroxyethylamino)ethyl]-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(CCNCCO)n1 |
| InChI | InChI=1S/C8H14N4O3/c1-15-8(14)7-10-6-12(11-7)4-2-9-3-5-13/h6,9,13H,2-5H2,1H3 |
| InChIKey | PEUQACCFFUOPDA-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|