C10H17N3O3 — CID 106453908
methyl 1-[2-(2-methylpropoxy)ethyl]-1,2,4-triazole-3-carboxylate (PubChem CID 106453908) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl 1-[2-(2-methylpropoxy)ethyl]-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-[2-(2-methylpropoxy)ethyl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 106453908 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | methyl 1-[2-(2-methylpropoxy)ethyl]-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(CCOCC(C)C)n1 |
| InChI | InChI=1S/C10H17N3O3/c1-8(2)6-16-5-4-13-7-11-9(12-13)10(14)15-3/h7-8H,4-6H2,1-3H3 |
| InChIKey | PQEJNROBBMSRAJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|