About methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate
methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate (PubChem CID 78925189) has the molecular formula C11H10BrN3O2
and a molecular weight of 296.12 g/mol. Its IUPAC name is methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate.
Analyze methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate?
The IUPAC name of methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate (CID 78925189) is methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate?
The canonical SMILES for methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate is COC(=O)c1ncn(Cc2cccc(Br)c2)n1.
What is the InChIKey of methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate?
The InChIKey is WIJBKZNJVTXROV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrN3O2/c1-17-11(16)10-13-7-15(14-10)6-8-3-2-4-9(12)5-8/h2-5,7H,6H2,1H3.
What are the key properties of methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate?
methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate has a molecular weight of 296.12 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(3-bromophenyl)methyl]-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 78925189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).