C33H34N6O6 — CID 165030118
[(2R,3S,5R)-2-[6-(diphenylcarbamoyloxy)-2-(2-methylpropanoylamino)purin-9-yl]-5-ethyl-5-ethynyl-4-methyloxolan-3-yl] acetate (PubChem CID 165030118) has the molecular formula C33H34N6O6 and a molecular weight of 610.67 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[6-(diphenylcarbamoyloxy)-2-(2-methylpropanoylamino)purin-9-yl]-5-ethyl-5-ethynyl-4-methyloxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-2-[6-(diphenylcarbamoyloxy)-2-(2-methylpropanoylamino)purin-9-yl]-5-ethyl-5-ethynyl-4-methyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 165030118 |
| Molecular Formula | C33H34N6O6 |
| Molecular Weight | 610.67 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | [(2R,3S,5R)-2-[6-(diphenylcarbamoyloxy)-2-(2-methylpropanoylamino)purin-9-yl]-5-ethyl-5-ethynyl-4-methyloxolan-3-yl] acetate |
| SMILES | C#C[C@]1(CC)O[C@@H](n2cnc3c(OC(=O)N(c4ccccc4)c4ccccc4)nc(NC(=O)C(C)C)nc32)[C@@H](OC(C)=O)C1C |
| InChI | InChI=1S/C33H34N6O6/c1-7-33(8-2)21(5)26(43-22(6)40)30(45-33)38-19-34-25-27(38)35-31(36-28(41)20(3)4)37-29(25)44-32(42)39(23-15-11-9-12-16-23)24-17-13-10-14-18-24/h1,9-21,26,30H,8H2,2-6H3,(H,35,36,37,41)/t21?,26-,30+,33+/m0/s1 |
| InChIKey | OXEUIWWYDFGVLV-AMAZTBRBSA-N |
| XLogP | 5.64 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|