C27H36O3 — CID 91127978
(2,6-ditert-butyl-4-methylphenyl) 2-(phenylmethoxymethyl)cyclopropane-1-carboxylate (PubChem CID 91127978) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylphenyl) 2-(phenylmethoxymethyl)cyclopropane-1-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methylphenyl) 2-(phenylmethoxymethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 91127978 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (2,6-ditert-butyl-4-methylphenyl) 2-(phenylmethoxymethyl)cyclopropane-1-carboxylate |
| SMILES | Cc1cc(C(C)(C)C)c(OC(=O)C2CC2COCc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H36O3/c1-18-13-22(26(2,3)4)24(23(14-18)27(5,6)7)30-25(28)21-15-20(21)17-29-16-19-11-9-8-10-12-19/h8-14,20-21H,15-17H2,1-7H3 |
| InChIKey | GXSGEMIOJWMRLX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|