C30H34O6 — CID 139988302
ethyl 2-methyl-3-[tris(4-methoxyphenyl)methoxymethyl]cyclopropane-1-carboxylate (PubChem CID 139988302) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is ethyl 2-methyl-3-[tris(4-methoxyphenyl)methoxymethyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-methyl-3-[tris(4-methoxyphenyl)methoxymethyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 139988302 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | ethyl 2-methyl-3-[tris(4-methoxyphenyl)methoxymethyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1C(C)C1COC(c1ccc(OC)cc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H34O6/c1-6-35-29(31)28-20(2)27(28)19-36-30(21-7-13-24(32-3)14-8-21,22-9-15-25(33-4)16-10-22)23-11-17-26(34-5)18-12-23/h7-18,20,27-28H,6,19H2,1-5H3 |
| InChIKey | TYQYIMSHPPEMST-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|