C18H24N2O2S — CID 2377001
N,N'-bis(4-ethoxyphenyl)-1-methylsulfanylmethanediamine (PubChem CID 2377001) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is N,N'-bis(4-ethoxyphenyl)-1-methylsulfanylmethanediamine.
| Compound Name | N,N'-bis(4-ethoxyphenyl)-1-methylsulfanylmethanediamine |
|---|---|
| PubChem CID | 2377001 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N,N'-bis(4-ethoxyphenyl)-1-methylsulfanylmethanediamine |
| SMILES | CCOc1ccc(NC(Nc2ccc(OCC)cc2)SC)cc1 |
| InChI | InChI=1S/C18H24N2O2S/c1-4-21-16-10-6-14(7-11-16)19-18(23-3)20-15-8-12-17(13-9-15)22-5-2/h6-13,18-20H,4-5H2,1-3H3 |
| InChIKey | UMDSMGBSMYHCQL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|