C14H18O5 — CID 15351525
[(E,4R,5R)-4,5-dihydroxyhex-2-enyl] 4-methoxybenzoate (PubChem CID 15351525) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is [(E,4R,5R)-4,5-dihydroxyhex-2-enyl] 4-methoxybenzoate.
| Compound Name | [(E,4R,5R)-4,5-dihydroxyhex-2-enyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 15351525 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [(E,4R,5R)-4,5-dihydroxyhex-2-enyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC/C=C/[C@@H](O)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C14H18O5/c1-10(15)13(16)4-3-9-19-14(17)11-5-7-12(18-2)8-6-11/h3-8,10,13,15-16H,9H2,1-2H3/b4-3+/t10-,13-/m1/s1 |
| InChIKey | RMKHKVWOAMWKPA-JZEAAEPLSA-N |
| XLogP | 1.15 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|