C16H14Cl3NO — CID 54756728
[(E)-3-(4-methylnaphthalen-1-yl)prop-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 54756728) has the molecular formula C16H14Cl3NO and a molecular weight of 342.65 g/mol. Its IUPAC name is [(E)-3-(4-methylnaphthalen-1-yl)prop-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E)-3-(4-methylnaphthalen-1-yl)prop-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 54756728 |
| Molecular Formula | C16H14Cl3NO |
| Molecular Weight | 342.65 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | [(E)-3-(4-methylnaphthalen-1-yl)prop-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C/c1ccc(C)c2ccccc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H14Cl3NO/c1-11-8-9-12(14-7-3-2-6-13(11)14)5-4-10-21-15(20)16(17,18)19/h2-9,20H,10H2,1H3/b5-4+,20-15+ |
| InChIKey | NVLIEFGFZZTDBQ-KNLQJOFJSA-N |
| XLogP | 5.53 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|