C11H9Cl3FNO — CID 21469208
[(E)-3-(3-fluorophenyl)prop-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 21469208) has the molecular formula C11H9Cl3FNO and a molecular weight of 296.56 g/mol. Its IUPAC name is [(E)-3-(3-fluorophenyl)prop-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E)-3-(3-fluorophenyl)prop-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 21469208 |
| Molecular Formula | C11H9Cl3FNO |
| Molecular Weight | 296.56 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | [(E)-3-(3-fluorophenyl)prop-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C/c1cccc(F)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H9Cl3FNO/c12-11(13,14)10(16)17-6-2-4-8-3-1-5-9(15)7-8/h1-5,7,16H,6H2/b4-2+,16-10+ |
| InChIKey | QWKIWBMXROKQMT-MFKPQTALSA-N |
| XLogP | 4.20 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|