C12H15FO2 — CID 71465696
1-[(E)-4,4-dimethoxybut-1-enyl]-3-fluorobenzene (PubChem CID 71465696) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 1-[(E)-4,4-dimethoxybut-1-enyl]-3-fluorobenzene.
| Compound Name | 1-[(E)-4,4-dimethoxybut-1-enyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 71465696 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-[(E)-4,4-dimethoxybut-1-enyl]-3-fluorobenzene |
| SMILES | COC(C/C=C/c1cccc(F)c1)OC |
| InChI | InChI=1S/C12H15FO2/c1-14-12(15-2)8-4-6-10-5-3-7-11(13)9-10/h3-7,9,12H,8H2,1-2H3/b6-4+ |
| InChIKey | OZCWRNSUJOGVEU-GQCTYLIASA-N |
| XLogP | 2.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|