C18H17F2N3O — CID 142836408
ethyl 4-amino-2-fluoro-5-[(E)-3-(3-fluorophenyl)prop-2-enimidoyl]benzenecarboximidate (PubChem CID 142836408) has the molecular formula C18H17F2N3O and a molecular weight of 329.35 g/mol. Its IUPAC name is ethyl 4-amino-2-fluoro-5-[(E)-3-(3-fluorophenyl)prop-2-enimidoyl]benzenecarboximidate.
| Compound Name | ethyl 4-amino-2-fluoro-5-[(E)-3-(3-fluorophenyl)prop-2-enimidoyl]benzenecarboximidate |
|---|---|
| PubChem CID | 142836408 |
| Molecular Formula | C18H17F2N3O |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | ethyl 4-amino-2-fluoro-5-[(E)-3-(3-fluorophenyl)prop-2-enimidoyl]benzenecarboximidate |
| SMILES | [H]/N=C(\OCC)c1cc(C(/C=C/c2cccc(F)c2)=N/[H])c(N)cc1F |
| InChI | InChI=1S/C18H17F2N3O/c1-2-24-18(23)13-9-14(17(22)10-15(13)20)16(21)7-6-11-4-3-5-12(19)8-11/h3-10,21,23H,2,22H2,1H3/b7-6+,21-16+,23-18- |
| InChIKey | YWZCAHNVTLFJFN-ULKWSXOASA-N |
| XLogP | 3.99 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|