C22H19F2N3O2S — CID 142836534
N-[4-amino-2-fluoro-5-[(E)-3-(4-fluoro-3-methoxyphenyl)prop-2-enimidoyl]phenyl]-2-thiophen-2-ylacetamide (PubChem CID 142836534) has the molecular formula C22H19F2N3O2S and a molecular weight of 427.48 g/mol. Its IUPAC name is N-[4-amino-2-fluoro-5-[(E)-3-(4-fluoro-3-methoxyphenyl)prop-2-enimidoyl]phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-amino-2-fluoro-5-[(E)-3-(4-fluoro-3-methoxyphenyl)prop-2-enimidoyl]phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 142836534 |
| Molecular Formula | C22H19F2N3O2S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-[4-amino-2-fluoro-5-[(E)-3-(4-fluoro-3-methoxyphenyl)prop-2-enimidoyl]phenyl]-2-thiophen-2-ylacetamide |
| SMILES | [H]/N=C(\C=C\c1ccc(F)c(OC)c1)c1cc(NC(=O)Cc2cccs2)c(F)cc1N |
| InChI | InChI=1S/C22H19F2N3O2S/c1-29-21-9-13(4-6-16(21)23)5-7-18(25)15-11-20(17(24)12-19(15)26)27-22(28)10-14-3-2-8-30-14/h2-9,11-12,25H,10,26H2,1H3,(H,27,28)/b7-5+,25-18+ |
| InChIKey | NCGSIQKYYNJWLU-YPRSSGBJSA-N |
| XLogP | 4.88 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|