C20H16F2N4O — CID 142835675
N-[4-amino-2-fluoro-5-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]phenyl]-1-cyanocyclopropane-1-carboxamide (PubChem CID 142835675) has the molecular formula C20H16F2N4O and a molecular weight of 366.37 g/mol. Its IUPAC name is N-[4-amino-2-fluoro-5-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]phenyl]-1-cyanocyclopropane-1-carboxamide.
| Compound Name | N-[4-amino-2-fluoro-5-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]phenyl]-1-cyanocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142835675 |
| Molecular Formula | C20H16F2N4O |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-[4-amino-2-fluoro-5-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]phenyl]-1-cyanocyclopropane-1-carboxamide |
| SMILES | [H]/N=C(\C=C\c1ccc(F)cc1)c1cc(NC(=O)C2(C#N)CC2)c(F)cc1N |
| InChI | InChI=1S/C20H16F2N4O/c21-13-4-1-12(2-5-13)3-6-16(24)14-9-18(15(22)10-17(14)25)26-19(27)20(11-23)7-8-20/h1-6,9-10,24H,7-8,25H2,(H,26,27)/b6-3+,24-16+ |
| InChIKey | WTGAFPJBRFKLOP-JFYSUSAFSA-N |
| XLogP | 3.87 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|