C21H17F2N5 — CID 142835684
2-fluoro-5-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-1-N-(1-pyrazin-2-ylethenyl)benzene-1,4-diamine (PubChem CID 142835684) has the molecular formula C21H17F2N5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-fluoro-5-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-1-N-(1-pyrazin-2-ylethenyl)benzene-1,4-diamine.
| Compound Name | 2-fluoro-5-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-1-N-(1-pyrazin-2-ylethenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 142835684 |
| Molecular Formula | C21H17F2N5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-fluoro-5-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-1-N-(1-pyrazin-2-ylethenyl)benzene-1,4-diamine |
| SMILES | [H]/N=C(\C=C\c1ccc(F)cc1)c1cc(NC(=C)c2cnccn2)c(F)cc1N |
| InChI | InChI=1S/C21H17F2N5/c1-13(21-12-26-8-9-27-21)28-20-10-16(19(25)11-17(20)23)18(24)7-4-14-2-5-15(22)6-3-14/h2-12,24,28H,1,25H2/b7-4+,24-18+ |
| InChIKey | INMJKZXOCGNRFK-KBRSAOHYSA-N |
| XLogP | 4.50 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|